C36H39FN4O7S — CID 125076950
(2R)-2-[(2-fluorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-N-(2-methylpropyl)-3-phenylpropanamide (PubChem CID 125076950) has the molecular formula C36H39FN4O7S and a molecular weight of 690.79 g/mol. Its IUPAC name is (2R)-2-[(2-fluorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-N-(2-methylpropyl)-3-phenylpropanamide.
| Compound Name | (2R)-2-[(2-fluorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-N-(2-methylpropyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 125076950 |
| Molecular Formula | C36H39FN4O7S |
| Molecular Weight | 690.79 g/mol |
| Exact Mass | 690.25 |
| IUPAC Name | (2R)-2-[(2-fluorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-N-(2-methylpropyl)-3-phenylpropanamide |
| SMILES | COc1ccc(N(CC(=O)N(Cc2ccccc2F)[C@H](Cc2ccccc2)C(=O)NCC(C)C)S(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C36H39FN4O7S/c1-25(2)22-38-36(43)34(20-27-10-6-5-7-11-27)39(23-28-12-8-9-13-32(28)37)35(42)24-40(29-15-17-30(48-4)18-16-29)49(46,47)31-19-14-26(3)33(21-31)41(44)45/h5-19,21,25,34H,20,22-24H2,1-4H3,(H,38,43)/t34-/m1/s1 |
| InChIKey | DAGFCJHGWFOXSP-UUWRZZSWSA-N |
| XLogP | 5.66 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.79 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|