C36H38Cl2N4O7S — CID 133193338
N-tert-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 133193338) has the molecular formula C36H38Cl2N4O7S and a molecular weight of 741.69 g/mol. Its IUPAC name is N-tert-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | N-tert-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133193338 |
| Molecular Formula | C36H38Cl2N4O7S |
| Molecular Weight | 741.69 g/mol |
| Exact Mass | 740.18 |
| IUPAC Name | N-tert-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | COc1ccc(N(CC(=O)N(Cc2ccc(Cl)cc2Cl)C(Cc2ccccc2)C(=O)NC(C)(C)C)S(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C36H38Cl2N4O7S/c1-24-11-18-30(21-32(24)42(45)46)50(47,48)41(28-14-16-29(49-5)17-15-28)23-34(43)40(22-26-12-13-27(37)20-31(26)38)33(35(44)39-36(2,3)4)19-25-9-7-6-8-10-25/h6-18,20-21,33H,19,22-23H2,1-5H3,(H,39,44) |
| InChIKey | AREBFAFKGCZMLO-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.69 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|