C35H37FN4O7S — CID 132645850
2-[(4-fluorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-3-phenyl-N-propylpropanamide (PubChem CID 132645850) has the molecular formula C35H37FN4O7S and a molecular weight of 676.77 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-3-phenyl-N-propylpropanamide.
| Compound Name | 2-[(4-fluorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-3-phenyl-N-propylpropanamide |
|---|---|
| PubChem CID | 132645850 |
| Molecular Formula | C35H37FN4O7S |
| Molecular Weight | 676.77 g/mol |
| Exact Mass | 676.24 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]-3-phenyl-N-propylpropanamide |
| SMILES | CCCNC(=O)C(Cc1ccccc1)N(Cc1ccc(F)cc1)C(=O)CN(c1ccc(OC)cc1)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C35H37FN4O7S/c1-4-20-37-35(42)33(21-26-8-6-5-7-9-26)38(23-27-11-13-28(36)14-12-27)34(41)24-39(29-15-17-30(47-3)18-16-29)48(45,46)31-19-10-25(2)32(22-31)40(43)44/h5-19,22,33H,4,20-21,23-24H2,1-3H3,(H,37,42) |
| InChIKey | ABCIEXYWRIJZMM-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.77 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|