C39H44N4O7S — CID 133176393
N-cyclohexyl-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 133176393) has the molecular formula C39H44N4O7S and a molecular weight of 712.87 g/mol. Its IUPAC name is N-cyclohexyl-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | N-cyclohexyl-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133176393 |
| Molecular Formula | C39H44N4O7S |
| Molecular Weight | 712.87 g/mol |
| Exact Mass | 712.29 |
| IUPAC Name | N-cyclohexyl-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | COc1ccc(N(CC(=O)N(Cc2cccc(C)c2)C(Cc2ccccc2)C(=O)NC2CCCCC2)S(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C39H44N4O7S/c1-28-11-10-14-31(23-28)26-41(37(24-30-12-6-4-7-13-30)39(45)40-32-15-8-5-9-16-32)38(44)27-42(33-18-20-34(50-3)21-19-33)51(48,49)35-22-17-29(2)36(25-35)43(46)47/h4,6-7,10-14,17-23,25,32,37H,5,8-9,15-16,24,26-27H2,1-3H3,(H,40,45) |
| InChIKey | YAWQCCGUVSLQHJ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.87 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|