C39H44N4O8S — CID 125070719
(2R)-N-cyclohexyl-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 125070719) has the molecular formula C39H44N4O8S and a molecular weight of 728.87 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-cyclohexyl-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 125070719 |
| Molecular Formula | C39H44N4O8S |
| Molecular Weight | 728.87 g/mol |
| Exact Mass | 728.29 |
| IUPAC Name | (2R)-N-cyclohexyl-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | COc1ccc(N(CC(=O)N(Cc2cccc(OC)c2)[C@H](Cc2ccccc2)C(=O)NC2CCCCC2)S(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C39H44N4O8S/c1-28-17-22-35(25-36(28)43(46)47)52(48,49)42(32-18-20-33(50-2)21-19-32)27-38(44)41(26-30-13-10-16-34(23-30)51-3)37(24-29-11-6-4-7-12-29)39(45)40-31-14-8-5-9-15-31/h4,6-7,10-13,16-23,25,31,37H,5,8-9,14-15,24,26-27H2,1-3H3,(H,40,45)/t37-/m1/s1 |
| InChIKey | DXHGNCBOBCBGBI-DIPNUNPCSA-N |
| XLogP | 6.20 |
| TPSA | 148.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.87 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|