C33H40N4O8S — CID 125053848
(2R)-N-cyclohexyl-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]propanamide (PubChem CID 125053848) has the molecular formula C33H40N4O8S and a molecular weight of 652.77 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]propanamide.
| Compound Name | (2R)-N-cyclohexyl-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]propanamide |
|---|---|
| PubChem CID | 125053848 |
| Molecular Formula | C33H40N4O8S |
| Molecular Weight | 652.77 g/mol |
| Exact Mass | 652.26 |
| IUPAC Name | (2R)-N-cyclohexyl-2-[[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]propanamide |
| SMILES | COc1ccc(N(CC(=O)N(Cc2cccc(OC)c2)[C@H](C)C(=O)NC2CCCCC2)S(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C33H40N4O8S/c1-23-13-18-30(20-31(23)37(40)41)46(42,43)36(27-14-16-28(44-3)17-15-27)22-32(38)35(21-25-9-8-12-29(19-25)45-4)24(2)33(39)34-26-10-6-5-7-11-26/h8-9,12-20,24,26H,5-7,10-11,21-22H2,1-4H3,(H,34,39)/t24-/m1/s1 |
| InChIKey | FWGAHIKPZGFSHP-XMMPIXPASA-N |
| XLogP | 4.98 |
| TPSA | 148.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.77 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|