C32H36Cl2N4O7S — CID 125062720
(2R)-N-cyclohexyl-2-[(3,4-dichlorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]propanamide (PubChem CID 125062720) has the molecular formula C32H36Cl2N4O7S and a molecular weight of 691.63 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-[(3,4-dichlorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]propanamide.
| Compound Name | (2R)-N-cyclohexyl-2-[(3,4-dichlorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 125062720 |
| Molecular Formula | C32H36Cl2N4O7S |
| Molecular Weight | 691.63 g/mol |
| Exact Mass | 690.17 |
| IUPAC Name | (2R)-N-cyclohexyl-2-[(3,4-dichlorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]propanamide |
| SMILES | COc1ccc(N(CC(=O)N(Cc2ccc(Cl)c(Cl)c2)[C@H](C)C(=O)NC2CCCCC2)S(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C32H36Cl2N4O7S/c1-21-9-15-27(18-30(21)38(41)42)46(43,44)37(25-11-13-26(45-3)14-12-25)20-31(39)36(19-23-10-16-28(33)29(34)17-23)22(2)32(40)35-24-7-5-4-6-8-24/h9-18,22,24H,4-8,19-20H2,1-3H3,(H,35,40)/t22-/m1/s1 |
| InChIKey | ZFERFHXHAKIRNE-JOCHJYFZSA-N |
| XLogP | 6.28 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.63 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|