C32H37FN4O7S — CID 125062545
(2R)-N-cyclohexyl-2-[(4-fluorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]propanamide (PubChem CID 125062545) has the molecular formula C32H37FN4O7S and a molecular weight of 640.73 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-[(4-fluorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]propanamide.
| Compound Name | (2R)-N-cyclohexyl-2-[(4-fluorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 125062545 |
| Molecular Formula | C32H37FN4O7S |
| Molecular Weight | 640.73 g/mol |
| Exact Mass | 640.24 |
| IUPAC Name | (2R)-N-cyclohexyl-2-[(4-fluorophenyl)methyl-[2-(4-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]amino]propanamide |
| SMILES | COc1ccc(N(CC(=O)N(Cc2ccc(F)cc2)[C@H](C)C(=O)NC2CCCCC2)S(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C32H37FN4O7S/c1-22-9-18-29(19-30(22)37(40)41)45(42,43)36(27-14-16-28(44-3)17-15-27)21-31(38)35(20-24-10-12-25(33)13-11-24)23(2)32(39)34-26-7-5-4-6-8-26/h9-19,23,26H,4-8,20-21H2,1-3H3,(H,34,39)/t23-/m1/s1 |
| InChIKey | YQEZGPAGBMNAIR-HSZRJFAPSA-N |
| XLogP | 5.11 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.73 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|