C34H41ClN4O7S — CID 100539211
(2R)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]-N-cyclohexylbutanamide (PubChem CID 100539211) has the molecular formula C34H41ClN4O7S and a molecular weight of 685.24 g/mol. Its IUPAC name is (2R)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]-N-cyclohexylbutanamide.
| Compound Name | (2R)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 100539211 |
| Molecular Formula | C34H41ClN4O7S |
| Molecular Weight | 685.24 g/mol |
| Exact Mass | 684.24 |
| IUPAC Name | (2R)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(3-methylphenyl)methyl]amino]-N-cyclohexylbutanamide |
| SMILES | CC[C@H](C(=O)NC1CCCCC1)N(Cc1cccc(C)c1)C(=O)CN(c1cc(Cl)ccc1OC)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C34H41ClN4O7S/c1-5-29(34(41)36-27-12-7-6-8-13-27)37(21-25-11-9-10-23(2)18-25)33(40)22-38(31-19-26(35)15-17-32(31)46-4)47(44,45)28-16-14-24(3)30(20-28)39(42)43/h9-11,14-20,27,29H,5-8,12-13,21-22H2,1-4H3,(H,36,41)/t29-/m1/s1 |
| InChIKey | MUWGQBLJKOCYLB-GDLZYMKVSA-N |
| XLogP | 6.33 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.24 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|