C33H38Cl2N4O7S — CID 100552705
(2S)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(2-chlorophenyl)methyl]amino]-N-cyclohexylbutanamide (PubChem CID 100552705) has the molecular formula C33H38Cl2N4O7S and a molecular weight of 705.66 g/mol. Its IUPAC name is (2S)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(2-chlorophenyl)methyl]amino]-N-cyclohexylbutanamide.
| Compound Name | (2S)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(2-chlorophenyl)methyl]amino]-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 100552705 |
| Molecular Formula | C33H38Cl2N4O7S |
| Molecular Weight | 705.66 g/mol |
| Exact Mass | 704.18 |
| IUPAC Name | (2S)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(2-chlorophenyl)methyl]amino]-N-cyclohexylbutanamide |
| SMILES | CC[C@@H](C(=O)NC1CCCCC1)N(Cc1ccccc1Cl)C(=O)CN(c1cc(Cl)ccc1OC)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C33H38Cl2N4O7S/c1-4-28(33(41)36-25-11-6-5-7-12-25)37(20-23-10-8-9-13-27(23)35)32(40)21-38(30-18-24(34)15-17-31(30)46-3)47(44,45)26-16-14-22(2)29(19-26)39(42)43/h8-10,13-19,25,28H,4-7,11-12,20-21H2,1-3H3,(H,36,41)/t28-/m0/s1 |
| InChIKey | BYGSTWQURMGZOL-NDEPHWFRSA-N |
| XLogP | 6.67 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.66 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|