C37H37Cl3N4O7S — CID 100530808
(2S)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-cyclopentyl-3-phenylpropanamide (PubChem CID 100530808) has the molecular formula C37H37Cl3N4O7S and a molecular weight of 788.15 g/mol. Its IUPAC name is (2S)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-cyclopentyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-cyclopentyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100530808 |
| Molecular Formula | C37H37Cl3N4O7S |
| Molecular Weight | 788.15 g/mol |
| Exact Mass | 786.14 |
| IUPAC Name | (2S)-2-[[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-cyclopentyl-3-phenylpropanamide |
| SMILES | COc1ccc(Cl)cc1N(CC(=O)N(Cc1ccc(Cl)cc1Cl)[C@@H](Cc1ccccc1)C(=O)NC1CCCC1)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C37H37Cl3N4O7S/c1-24-12-16-30(21-32(24)44(47)48)52(49,50)43(33-20-28(39)15-17-35(33)51-2)23-36(45)42(22-26-13-14-27(38)19-31(26)40)34(18-25-8-4-3-5-9-25)37(46)41-29-10-6-7-11-29/h3-5,8-9,12-17,19-21,29,34H,6-7,10-11,18,22-23H2,1-2H3,(H,41,46)/t34-/m0/s1 |
| InChIKey | PCJUYALBQMGOBY-UMSFTDKQSA-N |
| XLogP | 7.77 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.15 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|