C26H27ClN4O8S2 — CID 43897997
1-[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-N,N-dimethyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 43897997) has the molecular formula C26H27ClN4O8S2 and a molecular weight of 623.11 g/mol. Its IUPAC name is 1-[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-N,N-dimethyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-N,N-dimethyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 43897997 |
| Molecular Formula | C26H27ClN4O8S2 |
| Molecular Weight | 623.11 g/mol |
| Exact Mass | 622.10 |
| IUPAC Name | 1-[2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)acetyl]-N,N-dimethyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | COc1ccc(Cl)cc1N(CC(=O)N1CCc2cc(S(=O)(=O)N(C)C)ccc21)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H27ClN4O8S2/c1-17-5-7-21(15-23(17)31(33)34)41(37,38)30(24-14-19(27)6-10-25(24)39-4)16-26(32)29-12-11-18-13-20(8-9-22(18)29)40(35,36)28(2)3/h5-10,13-15H,11-12,16H2,1-4H3 |
| InChIKey | YHNZPQGJTXSTRF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 147.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.11 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|