C24H24ClN3O7S — CID 51345513
2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-(2-methoxy-5-methylphenyl)acetamide (PubChem CID 51345513) has the molecular formula C24H24ClN3O7S and a molecular weight of 533.99 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-(2-methoxy-5-methylphenyl)acetamide.
| Compound Name | 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-(2-methoxy-5-methylphenyl)acetamide |
|---|---|
| PubChem CID | 51345513 |
| Molecular Formula | C24H24ClN3O7S |
| Molecular Weight | 533.99 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-(2-methoxy-5-methylphenyl)acetamide |
| SMILES | COc1ccc(C)cc1NC(=O)CN(c1cc(Cl)ccc1OC)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H24ClN3O7S/c1-15-5-9-22(34-3)19(11-15)26-24(29)14-27(21-12-17(25)7-10-23(21)35-4)36(32,33)18-8-6-16(2)20(13-18)28(30)31/h5-13H,14H2,1-4H3,(H,26,29) |
| InChIKey | HPTKSPCISPBODE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.99 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|