C26H28ClN3O6S — CID 43898068
2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[1-(3,4-dimethylphenyl)ethyl]acetamide (PubChem CID 43898068) has the molecular formula C26H28ClN3O6S and a molecular weight of 546.05 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[1-(3,4-dimethylphenyl)ethyl]acetamide.
| Compound Name | 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[1-(3,4-dimethylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 43898068 |
| Molecular Formula | C26H28ClN3O6S |
| Molecular Weight | 546.05 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[1-(3,4-dimethylphenyl)ethyl]acetamide |
| SMILES | COc1ccc(Cl)cc1N(CC(=O)NC(C)c1ccc(C)c(C)c1)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H28ClN3O6S/c1-16-6-8-20(12-18(16)3)19(4)28-26(31)15-29(24-13-21(27)9-11-25(24)36-5)37(34,35)22-10-7-17(2)23(14-22)30(32)33/h6-14,19H,15H2,1-5H3,(H,28,31) |
| InChIKey | OZAYHJCSSBKPHZ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.05 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|