C26H28ClN3O8S2 — CID 43898072
2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[1-(4-methylsulfonylphenyl)propyl]acetamide (PubChem CID 43898072) has the molecular formula C26H28ClN3O8S2 and a molecular weight of 610.11 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[1-(4-methylsulfonylphenyl)propyl]acetamide.
| Compound Name | 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[1-(4-methylsulfonylphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 43898072 |
| Molecular Formula | C26H28ClN3O8S2 |
| Molecular Weight | 610.11 g/mol |
| Exact Mass | 609.10 |
| IUPAC Name | 2-(5-chloro-2-methoxy-N-(4-methyl-3-nitrophenyl)sulfonylanilino)-N-[1-(4-methylsulfonylphenyl)propyl]acetamide |
| SMILES | CCC(NC(=O)CN(c1cc(Cl)ccc1OC)S(=O)(=O)c1ccc(C)c([N+](=O)[O-])c1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C26H28ClN3O8S2/c1-5-22(18-7-11-20(12-8-18)39(4,34)35)28-26(31)16-29(24-14-19(27)9-13-25(24)38-3)40(36,37)21-10-6-17(2)23(15-21)30(32)33/h6-15,22H,5,16H2,1-4H3,(H,28,31) |
| InChIKey | XWNFXIZJNCSATJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 152.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.11 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|