C23H27ClN2O6S — CID 1076440
ethyl 1-[2-(4-chloro-N-(4-methoxyphenyl)sulfonylanilino)acetyl]piperidine-4-carboxylate (PubChem CID 1076440) has the molecular formula C23H27ClN2O6S and a molecular weight of 495.00 g/mol. Its IUPAC name is ethyl 1-[2-(4-chloro-N-(4-methoxyphenyl)sulfonylanilino)acetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-(4-chloro-N-(4-methoxyphenyl)sulfonylanilino)acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 1076440 |
| Molecular Formula | C23H27ClN2O6S |
| Molecular Weight | 495.00 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | ethyl 1-[2-(4-chloro-N-(4-methoxyphenyl)sulfonylanilino)acetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)CN(c2ccc(Cl)cc2)S(=O)(=O)c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C23H27ClN2O6S/c1-3-32-23(28)17-12-14-25(15-13-17)22(27)16-26(19-6-4-18(24)5-7-19)33(29,30)21-10-8-20(31-2)9-11-21/h4-11,17H,3,12-16H2,1-2H3 |
| InChIKey | UZPACQQHVWMUEP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.00 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |