C20H23FN2O5S2 — CID 30267747
ethyl 1-[2-(4-fluoro-N-thiophen-2-ylsulfonylanilino)acetyl]piperidine-4-carboxylate (PubChem CID 30267747) has the molecular formula C20H23FN2O5S2 and a molecular weight of 454.55 g/mol. Its IUPAC name is ethyl 1-[2-(4-fluoro-N-thiophen-2-ylsulfonylanilino)acetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-(4-fluoro-N-thiophen-2-ylsulfonylanilino)acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 30267747 |
| Molecular Formula | C20H23FN2O5S2 |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | ethyl 1-[2-(4-fluoro-N-thiophen-2-ylsulfonylanilino)acetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)CN(c2ccc(F)cc2)S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C20H23FN2O5S2/c1-2-28-20(25)15-9-11-22(12-10-15)18(24)14-23(17-7-5-16(21)6-8-17)30(26,27)19-4-3-13-29-19/h3-8,13,15H,2,9-12,14H2,1H3 |
| InChIKey | FKARWVVPEVZBCQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |