C21H24ClN3O4S — CID 126031541
1-[2-[N-(benzenesulfonyl)-4-chloro-2-methylanilino]acetyl]piperidine-4-carboxamide (PubChem CID 126031541) has the molecular formula C21H24ClN3O4S and a molecular weight of 449.96 g/mol. Its IUPAC name is 1-[2-[N-(benzenesulfonyl)-4-chloro-2-methylanilino]acetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[N-(benzenesulfonyl)-4-chloro-2-methylanilino]acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126031541 |
| Molecular Formula | C21H24ClN3O4S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 1-[2-[N-(benzenesulfonyl)-4-chloro-2-methylanilino]acetyl]piperidine-4-carboxamide |
| SMILES | Cc1cc(Cl)ccc1N(CC(=O)N1CCC(C(N)=O)CC1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H24ClN3O4S/c1-15-13-17(22)7-8-19(15)25(30(28,29)18-5-3-2-4-6-18)14-20(26)24-11-9-16(10-12-24)21(23)27/h2-8,13,16H,9-12,14H2,1H3,(H2,23,27) |
| InChIKey | OHTCGCALWKARCS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |