C27H29ClN2O3S — CID 51343685
N-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-N-(5-chloro-2-methylphenyl)benzenesulfonamide (PubChem CID 51343685) has the molecular formula C27H29ClN2O3S and a molecular weight of 497.06 g/mol. Its IUPAC name is N-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-N-(5-chloro-2-methylphenyl)benzenesulfonamide.
| Compound Name | N-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-N-(5-chloro-2-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 51343685 |
| Molecular Formula | C27H29ClN2O3S |
| Molecular Weight | 497.06 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | N-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-N-(5-chloro-2-methylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(Cl)cc1N(CC(=O)N1CCC(Cc2ccccc2)CC1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H29ClN2O3S/c1-21-12-13-24(28)19-26(21)30(34(32,33)25-10-6-3-7-11-25)20-27(31)29-16-14-23(15-17-29)18-22-8-4-2-5-9-22/h2-13,19,23H,14-18,20H2,1H3 |
| InChIKey | HYHHPQDXTQZEHO-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.06 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |