C26H27IN2O3S — CID 126178030
N-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-N-(4-iodophenyl)benzenesulfonamide (PubChem CID 126178030) has the molecular formula C26H27IN2O3S and a molecular weight of 574.48 g/mol. Its IUPAC name is N-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-N-(4-iodophenyl)benzenesulfonamide.
| Compound Name | N-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-N-(4-iodophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 126178030 |
| Molecular Formula | C26H27IN2O3S |
| Molecular Weight | 574.48 g/mol |
| Exact Mass | 574.08 |
| IUPAC Name | N-[2-(4-benzylpiperidin-1-yl)-2-oxoethyl]-N-(4-iodophenyl)benzenesulfonamide |
| SMILES | O=C(CN(c1ccc(I)cc1)S(=O)(=O)c1ccccc1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H27IN2O3S/c27-23-11-13-24(14-12-23)29(33(31,32)25-9-5-2-6-10-25)20-26(30)28-17-15-22(16-18-28)19-21-7-3-1-4-8-21/h1-14,22H,15-20H2 |
| InChIKey | GNFBOQXEHJZDFN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|