C16H23FN4O4S — CID 92684224
1-[2-[N-(dimethylsulfamoyl)-2-fluoroanilino]acetyl]piperidine-4-carboxamide (PubChem CID 92684224) has the molecular formula C16H23FN4O4S and a molecular weight of 386.45 g/mol. Its IUPAC name is 1-[2-[N-(dimethylsulfamoyl)-2-fluoroanilino]acetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[N-(dimethylsulfamoyl)-2-fluoroanilino]acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 92684224 |
| Molecular Formula | C16H23FN4O4S |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 1-[2-[N-(dimethylsulfamoyl)-2-fluoroanilino]acetyl]piperidine-4-carboxamide |
| SMILES | CN(C)S(=O)(=O)N(CC(=O)N1CCC(C(N)=O)CC1)c1ccccc1F |
| InChI | InChI=1S/C16H23FN4O4S/c1-19(2)26(24,25)21(14-6-4-3-5-13(14)17)11-15(22)20-9-7-12(8-10-20)16(18)23/h3-6,12H,7-11H2,1-2H3,(H2,18,23) |
| InChIKey | MOVOYOINYRORDL-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |