C20H25FN4O3S — CID 53283438
2-[N-(dimethylsulfamoyl)-2-fluoroanilino]-1-(4-phenylpiperazin-1-yl)ethanone (PubChem CID 53283438) has the molecular formula C20H25FN4O3S and a molecular weight of 420.51 g/mol. Its IUPAC name is 2-[N-(dimethylsulfamoyl)-2-fluoroanilino]-1-(4-phenylpiperazin-1-yl)ethanone.
| Compound Name | 2-[N-(dimethylsulfamoyl)-2-fluoroanilino]-1-(4-phenylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 53283438 |
| Molecular Formula | C20H25FN4O3S |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 2-[N-(dimethylsulfamoyl)-2-fluoroanilino]-1-(4-phenylpiperazin-1-yl)ethanone |
| SMILES | CN(C)S(=O)(=O)N(CC(=O)N1CCN(c2ccccc2)CC1)c1ccccc1F |
| InChI | InChI=1S/C20H25FN4O3S/c1-22(2)29(27,28)25(19-11-7-6-10-18(19)21)16-20(26)24-14-12-23(13-15-24)17-8-4-3-5-9-17/h3-11H,12-16H2,1-2H3 |
| InChIKey | QEZZDBDRKHVKLY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |