C17H20FN5O3S — CID 113154693
N-(2-fluorophenyl)-N-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]methanesulfonamide (PubChem CID 113154693) has the molecular formula C17H20FN5O3S and a molecular weight of 393.44 g/mol. Its IUPAC name is N-(2-fluorophenyl)-N-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]methanesulfonamide.
| Compound Name | N-(2-fluorophenyl)-N-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 113154693 |
| Molecular Formula | C17H20FN5O3S |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | N-(2-fluorophenyl)-N-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)N(CC(=O)N1CCN(c2ncccn2)CC1)c1ccccc1F |
| InChI | InChI=1S/C17H20FN5O3S/c1-27(25,26)23(15-6-3-2-5-14(15)18)13-16(24)21-9-11-22(12-10-21)17-19-7-4-8-20-17/h2-8H,9-13H2,1H3 |
| InChIKey | UGZPRZKLPHQTCC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 86.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |