C19H24FN5O — CID 55568353
3-[(2-fluorophenyl)methyl-methylamino]-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one (PubChem CID 55568353) has the molecular formula C19H24FN5O and a molecular weight of 357.43 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)methyl-methylamino]-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one.
| Compound Name | 3-[(2-fluorophenyl)methyl-methylamino]-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 55568353 |
| Molecular Formula | C19H24FN5O |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 3-[(2-fluorophenyl)methyl-methylamino]-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one |
| SMILES | CN(CCC(=O)N1CCN(c2ncccn2)CC1)Cc1ccccc1F |
| InChI | InChI=1S/C19H24FN5O/c1-23(15-16-5-2-3-6-17(16)20)10-7-18(26)24-11-13-25(14-12-24)19-21-8-4-9-22-19/h2-6,8-9H,7,10-15H2,1H3 |
| InChIKey | ISMUCVWVXXLGHQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |