C16H23FN2O — CID 78791327
1-(azepan-1-yl)-2-[(2-fluorophenyl)methyl-methylamino]ethanone (PubChem CID 78791327) has the molecular formula C16H23FN2O and a molecular weight of 278.37 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[(2-fluorophenyl)methyl-methylamino]ethanone.
| Compound Name | 1-(azepan-1-yl)-2-[(2-fluorophenyl)methyl-methylamino]ethanone |
|---|---|
| PubChem CID | 78791327 |
| Molecular Formula | C16H23FN2O |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 1-(azepan-1-yl)-2-[(2-fluorophenyl)methyl-methylamino]ethanone |
| SMILES | CN(CC(=O)N1CCCCCC1)Cc1ccccc1F |
| InChI | InChI=1S/C16H23FN2O/c1-18(12-14-8-4-5-9-15(14)17)13-16(20)19-10-6-2-3-7-11-19/h4-5,8-9H,2-3,6-7,10-13H2,1H3 |
| InChIKey | FYTJZTNAMCJKEJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |