C16H23FN2O3S — CID 113139188
N-[(2-fluorophenyl)methyl]-N-(3-oxo-3-piperidin-1-ylpropyl)methanesulfonamide (PubChem CID 113139188) has the molecular formula C16H23FN2O3S and a molecular weight of 342.44 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-N-(3-oxo-3-piperidin-1-ylpropyl)methanesulfonamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-N-(3-oxo-3-piperidin-1-ylpropyl)methanesulfonamide |
|---|---|
| PubChem CID | 113139188 |
| Molecular Formula | C16H23FN2O3S |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-N-(3-oxo-3-piperidin-1-ylpropyl)methanesulfonamide |
| SMILES | CS(=O)(=O)N(CCC(=O)N1CCCCC1)Cc1ccccc1F |
| InChI | InChI=1S/C16H23FN2O3S/c1-23(21,22)19(13-14-7-3-4-8-15(14)17)12-9-16(20)18-10-5-2-6-11-18/h3-4,7-8H,2,5-6,9-13H2,1H3 |
| InChIKey | KRQSXEUSRIDXCX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |