C13H20N2O4S — CID 113138450
N-(furan-2-ylmethyl)-N-(3-oxo-3-pyrrolidin-1-ylpropyl)methanesulfonamide (PubChem CID 113138450) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-(3-oxo-3-pyrrolidin-1-ylpropyl)methanesulfonamide.
| Compound Name | N-(furan-2-ylmethyl)-N-(3-oxo-3-pyrrolidin-1-ylpropyl)methanesulfonamide |
|---|---|
| PubChem CID | 113138450 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-(3-oxo-3-pyrrolidin-1-ylpropyl)methanesulfonamide |
| SMILES | CS(=O)(=O)N(CCC(=O)N1CCCC1)Cc1ccco1 |
| InChI | InChI=1S/C13H20N2O4S/c1-20(17,18)15(11-12-5-4-10-19-12)9-6-13(16)14-7-2-3-8-14/h4-5,10H,2-3,6-9,11H2,1H3 |
| InChIKey | OOEXFICDHOUYSV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |