C17H28N6O2 — CID 113117515
N-[2-(dimethylamino)ethyl]-N-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]acetamide (PubChem CID 113117515) has the molecular formula C17H28N6O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]acetamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 113117515 |
| Molecular Formula | C17H28N6O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]acetamide |
| SMILES | CC(=O)N(CCC(=O)N1CCN(c2ncccn2)CC1)CCN(C)C |
| InChI | InChI=1S/C17H28N6O2/c1-15(24)21(10-9-20(2)3)8-5-16(25)22-11-13-23(14-12-22)17-18-6-4-7-19-17/h4,6-7H,5,8-14H2,1-3H3 |
| InChIKey | YEUABMJPJGVLCM-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 72.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |