C15H24N6O2 — CID 108943839
N-[2-(dimethylamino)ethyl]-3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propanamide (PubChem CID 108943839) has the molecular formula C15H24N6O2 and a molecular weight of 320.40 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propanamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 108943839 |
| Molecular Formula | C15H24N6O2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propanamide |
| SMILES | CN(C)CCNC(=O)CC(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C15H24N6O2/c1-19(2)7-6-16-13(22)12-14(23)20-8-10-21(11-9-20)15-17-4-3-5-18-15/h3-5H,6-12H2,1-2H3,(H,16,22) |
| InChIKey | XAXWEYRGFLOKKR-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|