C18H26N2O5S — CID 46418830
ethyl 1-[2-(2-methyl-N-methylsulfonylanilino)acetyl]piperidine-3-carboxylate (PubChem CID 46418830) has the molecular formula C18H26N2O5S and a molecular weight of 382.48 g/mol. Its IUPAC name is ethyl 1-[2-(2-methyl-N-methylsulfonylanilino)acetyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-(2-methyl-N-methylsulfonylanilino)acetyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 46418830 |
| Molecular Formula | C18H26N2O5S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | ethyl 1-[2-(2-methyl-N-methylsulfonylanilino)acetyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)CN(c2ccccc2C)S(C)(=O)=O)C1 |
| InChI | InChI=1S/C18H26N2O5S/c1-4-25-18(22)15-9-7-11-19(12-15)17(21)13-20(26(3,23)24)16-10-6-5-8-14(16)2/h5-6,8,10,15H,4,7,9,11-13H2,1-3H3 |
| InChIKey | WFUIRZPNGZJUMS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |