C15H22Cl2N2O3S — CID 113146504
3-(2,4-dichloro-N-methylsulfonylanilino)-N-(3-methylbutyl)propanamide (PubChem CID 113146504) has the molecular formula C15H22Cl2N2O3S and a molecular weight of 381.33 g/mol. Its IUPAC name is 3-(2,4-dichloro-N-methylsulfonylanilino)-N-(3-methylbutyl)propanamide.
| Compound Name | 3-(2,4-dichloro-N-methylsulfonylanilino)-N-(3-methylbutyl)propanamide |
|---|---|
| PubChem CID | 113146504 |
| Molecular Formula | C15H22Cl2N2O3S |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 3-(2,4-dichloro-N-methylsulfonylanilino)-N-(3-methylbutyl)propanamide |
| SMILES | CC(C)CCNC(=O)CCN(c1ccc(Cl)cc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C15H22Cl2N2O3S/c1-11(2)6-8-18-15(20)7-9-19(23(3,21)22)14-5-4-12(16)10-13(14)17/h4-5,10-11H,6-9H2,1-3H3,(H,18,20) |
| InChIKey | OPOHRNLYYUNIQD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |