C19H22Cl2N2O3S — CID 126270307
2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-(3-methylbutyl)acetamide (PubChem CID 126270307) has the molecular formula C19H22Cl2N2O3S and a molecular weight of 429.37 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-(3-methylbutyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-(3-methylbutyl)acetamide |
|---|---|
| PubChem CID | 126270307 |
| Molecular Formula | C19H22Cl2N2O3S |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-(3-methylbutyl)acetamide |
| SMILES | CC(C)CCNC(=O)CN(c1ccc(Cl)cc1Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H22Cl2N2O3S/c1-14(2)10-11-22-19(24)13-23(18-9-8-15(20)12-17(18)21)27(25,26)16-6-4-3-5-7-16/h3-9,12,14H,10-11,13H2,1-2H3,(H,22,24) |
| InChIKey | PCTVGUZKHHQFMB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |