C24H24Cl2N2O4S — CID 30209863
2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-[3-(3-methoxyphenyl)propyl]acetamide (PubChem CID 30209863) has the molecular formula C24H24Cl2N2O4S and a molecular weight of 507.44 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-[3-(3-methoxyphenyl)propyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-[3-(3-methoxyphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 30209863 |
| Molecular Formula | C24H24Cl2N2O4S |
| Molecular Weight | 507.44 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-[3-(3-methoxyphenyl)propyl]acetamide |
| SMILES | COc1cccc(CCCNC(=O)CN(c2ccc(Cl)cc2Cl)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H24Cl2N2O4S/c1-32-20-9-5-7-18(15-20)8-6-14-27-24(29)17-28(23-13-12-19(25)16-22(23)26)33(30,31)21-10-3-2-4-11-21/h2-5,7,9-13,15-16H,6,8,14,17H2,1H3,(H,27,29) |
| InChIKey | FVYKORSPOKOMJV-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|