C26H29ClN2O4S — CID 30216577
2-(5-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[3-(3-methoxyphenyl)propyl]acetamide (PubChem CID 30216577) has the molecular formula C26H29ClN2O4S and a molecular weight of 501.05 g/mol. Its IUPAC name is 2-(5-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[3-(3-methoxyphenyl)propyl]acetamide.
| Compound Name | 2-(5-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[3-(3-methoxyphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 30216577 |
| Molecular Formula | C26H29ClN2O4S |
| Molecular Weight | 501.05 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | 2-(5-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)-N-[3-(3-methoxyphenyl)propyl]acetamide |
| SMILES | COc1cccc(CCCNC(=O)CN(c2cc(Cl)ccc2C)S(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C26H29ClN2O4S/c1-19-9-13-24(14-10-19)34(31,32)29(25-17-22(27)12-11-20(25)2)18-26(30)28-15-5-7-21-6-4-8-23(16-21)33-3/h4,6,8-14,16-17H,5,7,15,18H2,1-3H3,(H,28,30) |
| InChIKey | HPAAPAAHENBVAR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.05 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|