C7H19N3O6S3 — CID 141436059
N-[2-[2-(methanesulfonamido)ethyl-methylsulfonylamino]ethyl]methanesulfonamide (PubChem CID 141436059) has the molecular formula C7H19N3O6S3 and a molecular weight of 337.45 g/mol. Its IUPAC name is N-[2-[2-(methanesulfonamido)ethyl-methylsulfonylamino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[2-(methanesulfonamido)ethyl-methylsulfonylamino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 141436059 |
| Molecular Formula | C7H19N3O6S3 |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | N-[2-[2-(methanesulfonamido)ethyl-methylsulfonylamino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCN(CCNS(C)(=O)=O)S(C)(=O)=O |
| InChI | InChI=1S/C7H19N3O6S3/c1-17(11,12)8-4-6-10(19(3,15)16)7-5-9-18(2,13)14/h8-9H,4-7H2,1-3H3 |
| InChIKey | FCJRJZLHESJHLS-UHFFFAOYSA-N |
| XLogP | -2.65 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |