C10H23N3O5S2 — CID 113066365
N-[2-[methylsulfonyl(2-morpholin-4-ylethyl)amino]ethyl]methanesulfonamide (PubChem CID 113066365) has the molecular formula C10H23N3O5S2 and a molecular weight of 329.44 g/mol. Its IUPAC name is N-[2-[methylsulfonyl(2-morpholin-4-ylethyl)amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[methylsulfonyl(2-morpholin-4-ylethyl)amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 113066365 |
| Molecular Formula | C10H23N3O5S2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | N-[2-[methylsulfonyl(2-morpholin-4-ylethyl)amino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCN(CCN1CCOCC1)S(C)(=O)=O |
| InChI | InChI=1S/C10H23N3O5S2/c1-19(14,15)11-3-4-13(20(2,16)17)6-5-12-7-9-18-10-8-12/h11H,3-10H2,1-2H3 |
| InChIKey | QDHMXTOFIJVJAE-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |