About 2-methylpropane;N-(morpholin-4-ylmethyl)methanesulfonamide
2-methylpropane;N-(morpholin-4-ylmethyl)methanesulfonamide (PubChem CID 158869058) has the molecular formula C10H24N2O3S
and a molecular weight of 252.38 g/mol. Its IUPAC name is 2-methylpropane;N-(morpholin-4-ylmethyl)methanesulfonamide.
Molecular Properties
| Compound Name | 2-methylpropane;N-(morpholin-4-ylmethyl)methanesulfonamide |
| PubChem CID | 158869058 |
| Molecular Formula | C10H24N2O3S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 2-methylpropane;N-(morpholin-4-ylmethyl)methanesulfonamide |
| SMILES | CC(C)C.CS(=O)(=O)NCN1CCOCC1 |
| InChI | InChI=1S/C6H14N2O3S.C4H10/c1-12(9,10)7-6-8-2-4-11-5-3-8;1-4(2)3/h7H,2-6H2,1H3;4H,1-3H3 |
| InChIKey | JBPPKICZIHYECR-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylpropane;N-(morpholin-4-ylmethyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane;N-(morpholin-4-ylmethyl)methanesulfonamide?
The IUPAC name of 2-methylpropane;N-(morpholin-4-ylmethyl)methanesulfonamide (CID 158869058) is 2-methylpropane;N-(morpholin-4-ylmethyl)methanesulfonamide.
What is the SMILES notation for 2-methylpropane;N-(morpholin-4-ylmethyl)methanesulfonamide?
The canonical SMILES for 2-methylpropane;N-(morpholin-4-ylmethyl)methanesulfonamide is CC(C)C.CS(=O)(=O)NCN1CCOCC1.
What is the InChIKey of 2-methylpropane;N-(morpholin-4-ylmethyl)methanesulfonamide?
The InChIKey is JBPPKICZIHYECR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O3S.C4H10/c1-12(9,10)7-6-8-2-4-11-5-3-8;1-4(2)3/h7H,2-6H2,1H3;4H,1-3H3.
What are the key properties of 2-methylpropane;N-(morpholin-4-ylmethyl)methanesulfonamide?
2-methylpropane;N-(morpholin-4-ylmethyl)methanesulfonamide has a molecular weight of 252.38 g/mol, XLogP of 0.49, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;N-(morpholin-4-ylmethyl)methanesulfonamide is sourced from PubChem (CID 158869058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).