C8H17N3O4S — CID 153399040
N-(ethylsulfamoyl)-2-morpholin-4-ylacetamide (PubChem CID 153399040) has the molecular formula C8H17N3O4S and a molecular weight of 251.31 g/mol. Its IUPAC name is N-(ethylsulfamoyl)-2-morpholin-4-ylacetamide.
| Compound Name | N-(ethylsulfamoyl)-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 153399040 |
| Molecular Formula | C8H17N3O4S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | N-(ethylsulfamoyl)-2-morpholin-4-ylacetamide |
| SMILES | CCNS(=O)(=O)NC(=O)CN1CCOCC1 |
| InChI | InChI=1S/C8H17N3O4S/c1-2-9-16(13,14)10-8(12)7-11-3-5-15-6-4-11/h9H,2-7H2,1H3,(H,10,12) |
| InChIKey | IIKNDAPKAUCEKY-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |