C11H18N2O4S — CID 7243445
N-[(2R)-2-(furan-2-yl)-2-morpholin-4-ylethyl]methanesulfonamide (PubChem CID 7243445) has the molecular formula C11H18N2O4S and a molecular weight of 274.34 g/mol. Its IUPAC name is N-[(2R)-2-(furan-2-yl)-2-morpholin-4-ylethyl]methanesulfonamide.
| Compound Name | N-[(2R)-2-(furan-2-yl)-2-morpholin-4-ylethyl]methanesulfonamide |
|---|---|
| PubChem CID | 7243445 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | N-[(2R)-2-(furan-2-yl)-2-morpholin-4-ylethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC[C@H](c1ccco1)N1CCOCC1 |
| InChI | InChI=1S/C11H18N2O4S/c1-18(14,15)12-9-10(11-3-2-6-17-11)13-4-7-16-8-5-13/h2-3,6,10,12H,4-5,7-9H2,1H3/t10-/m1/s1 |
| InChIKey | TUIRVXDCABLCLK-SNVBAGLBSA-N |
| XLogP | 0.20 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |