C11H17ClN2O3S — CID 55245447
1-chloro-N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]methanesulfonamide (PubChem CID 55245447) has the molecular formula C11H17ClN2O3S and a molecular weight of 292.79 g/mol. Its IUPAC name is 1-chloro-N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]methanesulfonamide.
| Compound Name | 1-chloro-N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]methanesulfonamide |
|---|---|
| PubChem CID | 55245447 |
| Molecular Formula | C11H17ClN2O3S |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 1-chloro-N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]methanesulfonamide |
| SMILES | O=S(=O)(CCl)NCC(c1ccco1)N1CCCC1 |
| InChI | InChI=1S/C11H17ClN2O3S/c12-9-18(15,16)13-8-10(11-4-3-7-17-11)14-5-1-2-6-14/h3-4,7,10,13H,1-2,5-6,8-9H2 |
| InChIKey | LPLAWIBEFKEGKE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|