C16H26N2O3S — CID 97078733
1-cyclobutyl-N-[(2S)-2-(furan-2-yl)-2-piperidin-1-ylethyl]methanesulfonamide (PubChem CID 97078733) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is 1-cyclobutyl-N-[(2S)-2-(furan-2-yl)-2-piperidin-1-ylethyl]methanesulfonamide.
| Compound Name | 1-cyclobutyl-N-[(2S)-2-(furan-2-yl)-2-piperidin-1-ylethyl]methanesulfonamide |
|---|---|
| PubChem CID | 97078733 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 1-cyclobutyl-N-[(2S)-2-(furan-2-yl)-2-piperidin-1-ylethyl]methanesulfonamide |
| SMILES | O=S(=O)(CC1CCC1)NC[C@@H](c1ccco1)N1CCCCC1 |
| InChI | InChI=1S/C16H26N2O3S/c19-22(20,13-14-6-4-7-14)17-12-15(16-8-5-11-21-16)18-9-2-1-3-10-18/h5,8,11,14-15,17H,1-4,6-7,9-10,12-13H2/t15-/m0/s1 |
| InChIKey | JLWANUPDOCLGOL-HNNXBMFYSA-N |
| XLogP | 2.53 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |