C14H23ClN2O3S — CID 116815945
4-chloro-N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]butane-1-sulfonamide (PubChem CID 116815945) has the molecular formula C14H23ClN2O3S and a molecular weight of 334.87 g/mol. Its IUPAC name is 4-chloro-N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]butane-1-sulfonamide.
| Compound Name | 4-chloro-N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 116815945 |
| Molecular Formula | C14H23ClN2O3S |
| Molecular Weight | 334.87 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 4-chloro-N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]butane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCCl)NCC(c1ccco1)N1CCCC1 |
| InChI | InChI=1S/C14H23ClN2O3S/c15-7-1-4-11-21(18,19)16-12-13(14-6-5-10-20-14)17-8-2-3-9-17/h5-6,10,13,16H,1-4,7-9,11-12H2 |
| InChIKey | KIXGKPXGXQXOJA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.87 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|