C15H18N2O5S2 — CID 124705074
4-[[(2R)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 124705074) has the molecular formula C15H18N2O5S2 and a molecular weight of 370.45 g/mol. Its IUPAC name is 4-[[(2R)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[[(2R)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 124705074 |
| Molecular Formula | C15H18N2O5S2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 4-[[(2R)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NC[C@H](c2ccco2)N2CCCC2)cs1 |
| InChI | InChI=1S/C15H18N2O5S2/c18-15(19)14-8-11(10-23-14)24(20,21)16-9-12(13-4-3-7-22-13)17-5-1-2-6-17/h3-4,7-8,10,12,16H,1-2,5-6,9H2,(H,18,19)/t12-/m1/s1 |
| InChIKey | OYAQSDYCNDKGHU-GFCCVEGCSA-N |
| XLogP | 2.15 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |