C17H21BrN2O5S2 — CID 47070129
2-bromo-N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-5-methylsulfonylbenzenesulfonamide (PubChem CID 47070129) has the molecular formula C17H21BrN2O5S2 and a molecular weight of 477.40 g/mol. Its IUPAC name is 2-bromo-N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-5-methylsulfonylbenzenesulfonamide.
| Compound Name | 2-bromo-N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-5-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 47070129 |
| Molecular Formula | C17H21BrN2O5S2 |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 476.01 |
| IUPAC Name | 2-bromo-N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-5-methylsulfonylbenzenesulfonamide |
| SMILES | CS(=O)(=O)c1ccc(Br)c(S(=O)(=O)NCC(c2ccco2)N2CCCC2)c1 |
| InChI | InChI=1S/C17H21BrN2O5S2/c1-26(21,22)13-6-7-14(18)17(11-13)27(23,24)19-12-15(16-5-4-10-25-16)20-8-2-3-9-20/h4-7,10-11,15,19H,2-3,8-9,12H2,1H3 |
| InChIKey | XWAPJVUGMNZLLI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |