C18H24N2O4S — CID 86767927
N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-4-methoxy-2-methylbenzenesulfonamide (PubChem CID 86767927) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-4-methoxy-2-methylbenzenesulfonamide.
| Compound Name | N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-4-methoxy-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 86767927 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-4-methoxy-2-methylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCC(c2ccco2)N2CCCC2)c(C)c1 |
| InChI | InChI=1S/C18H24N2O4S/c1-14-12-15(23-2)7-8-18(14)25(21,22)19-13-16(17-6-5-11-24-17)20-9-3-4-10-20/h5-8,11-12,16,19H,3-4,9-10,13H2,1-2H3 |
| InChIKey | NHXLDLVPWPZNHL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |