C23H25F2N3O4S — CID 27443402
2,5-difluoro-N-[(2S)-2-(furan-2-yl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]benzenesulfonamide (PubChem CID 27443402) has the molecular formula C23H25F2N3O4S and a molecular weight of 477.53 g/mol. Its IUPAC name is 2,5-difluoro-N-[(2S)-2-(furan-2-yl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]benzenesulfonamide.
| Compound Name | 2,5-difluoro-N-[(2S)-2-(furan-2-yl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 27443402 |
| Molecular Formula | C23H25F2N3O4S |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 2,5-difluoro-N-[(2S)-2-(furan-2-yl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]benzenesulfonamide |
| SMILES | COc1ccc(N2CCN([C@@H](CNS(=O)(=O)c3cc(F)ccc3F)c3ccco3)CC2)cc1 |
| InChI | InChI=1S/C23H25F2N3O4S/c1-31-19-7-5-18(6-8-19)27-10-12-28(13-11-27)21(22-3-2-14-32-22)16-26-33(29,30)23-15-17(24)4-9-20(23)25/h2-9,14-15,21,26H,10-13,16H2,1H3/t21-/m0/s1 |
| InChIKey | RTTALBQNGVAIED-NRFANRHFSA-N |
| XLogP | 3.41 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|