C21H28N4O5 — CID 7163027
N'-[(2R)-2-(furan-2-yl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-N-(2-hydroxyethyl)oxamide (PubChem CID 7163027) has the molecular formula C21H28N4O5 and a molecular weight of 416.48 g/mol. Its IUPAC name is N'-[(2R)-2-(furan-2-yl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-N-(2-hydroxyethyl)oxamide.
| Compound Name | N'-[(2R)-2-(furan-2-yl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-N-(2-hydroxyethyl)oxamide |
|---|---|
| PubChem CID | 7163027 |
| Molecular Formula | C21H28N4O5 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | N'-[(2R)-2-(furan-2-yl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]-N-(2-hydroxyethyl)oxamide |
| SMILES | COc1ccc(N2CCN([C@H](CNC(=O)C(=O)NCCO)c3ccco3)CC2)cc1 |
| InChI | InChI=1S/C21H28N4O5/c1-29-17-6-4-16(5-7-17)24-9-11-25(12-10-24)18(19-3-2-14-30-19)15-23-21(28)20(27)22-8-13-26/h2-7,14,18,26H,8-13,15H2,1H3,(H,22,27)(H,23,28)/t18-/m1/s1 |
| InChIKey | AJTAPGKMWPZZOS-GOSISDBHSA-N |
| XLogP | 0.38 |
| TPSA | 107.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|