C23H32N4O6 — CID 16809973
N'-(2,2-dimethoxyethyl)-N-[2-(furan-2-yl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]oxamide (PubChem CID 16809973) has the molecular formula C23H32N4O6 and a molecular weight of 460.53 g/mol. Its IUPAC name is N'-(2,2-dimethoxyethyl)-N-[2-(furan-2-yl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]oxamide.
| Compound Name | N'-(2,2-dimethoxyethyl)-N-[2-(furan-2-yl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]oxamide |
|---|---|
| PubChem CID | 16809973 |
| Molecular Formula | C23H32N4O6 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | N'-(2,2-dimethoxyethyl)-N-[2-(furan-2-yl)-2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl]oxamide |
| SMILES | COc1ccc(N2CCN(C(CNC(=O)C(=O)NCC(OC)OC)c3ccco3)CC2)cc1 |
| InChI | InChI=1S/C23H32N4O6/c1-30-18-8-6-17(7-9-18)26-10-12-27(13-11-26)19(20-5-4-14-33-20)15-24-22(28)23(29)25-16-21(31-2)32-3/h4-9,14,19,21H,10-13,15-16H2,1-3H3,(H,24,28)(H,25,29) |
| InChIKey | HBRZAGFXFCLPPK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 105.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|