C11H22N2O3S — CID 113065214
2,2-dimethyl-N-[2-[methylsulfonyl(prop-2-enyl)amino]ethyl]propanamide (PubChem CID 113065214) has the molecular formula C11H22N2O3S and a molecular weight of 262.38 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2-[methylsulfonyl(prop-2-enyl)amino]ethyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[2-[methylsulfonyl(prop-2-enyl)amino]ethyl]propanamide |
|---|---|
| PubChem CID | 113065214 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2,2-dimethyl-N-[2-[methylsulfonyl(prop-2-enyl)amino]ethyl]propanamide |
| SMILES | C=CCN(CCNC(=O)C(C)(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C11H22N2O3S/c1-6-8-13(17(5,15)16)9-7-12-10(14)11(2,3)4/h6H,1,7-9H2,2-5H3,(H,12,14) |
| InChIKey | BSRKPJZJJAYPAH-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|