C11H24N2O3S — CID 61150790
N-[3-[ethyl(methylsulfonyl)amino]propyl]-2,2-dimethylpropanamide (PubChem CID 61150790) has the molecular formula C11H24N2O3S and a molecular weight of 264.39 g/mol. Its IUPAC name is N-[3-[ethyl(methylsulfonyl)amino]propyl]-2,2-dimethylpropanamide.
| Compound Name | N-[3-[ethyl(methylsulfonyl)amino]propyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 61150790 |
| Molecular Formula | C11H24N2O3S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N-[3-[ethyl(methylsulfonyl)amino]propyl]-2,2-dimethylpropanamide |
| SMILES | CCN(CCCNC(=O)C(C)(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C11H24N2O3S/c1-6-13(17(5,15)16)9-7-8-12-10(14)11(2,3)4/h6-9H2,1-5H3,(H,12,14) |
| InChIKey | CCRANWIISGJMMN-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|